![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 002 Do so - Meaning and examples (Learn)-en.srt | 2019-07-03 15:49 | 7.5K | |
| 002 Do so - Meaning and examples (Learn).mp4 | 2019-07-03 16:32 | 23M | |
| 003 Do so - Structure (Learn)-en.srt | 2019-07-03 15:50 | 2.4K | |
| 003 Do so - Structure (Learn).mp4 | 2019-07-03 16:32 | 7.9M | |
| 004 Do so - Things to note (Learn)-en.srt | 2019-07-03 15:51 | 2.0K | |
| 004 Do so - Things to note (Learn).mp4 | 2019-07-03 16:32 | 7.3M | |
| 005 Do so - Speaking practice (Master)-en.srt | 2019-07-03 15:51 | 2.0K | |
| 005 Do so - Speaking practice (Master).mp4 | 2019-07-03 16:30 | 5.4M | |
| 006 Do-so-MP3-transcript.pdf | 2019-07-03 16:31 | 83K | |
| 006 Do-so.mp3 | 2019-07-03 16:31 | 4.4M | |
| 006 Do so - Listening practice (Master)-en.srt | 2019-07-03 15:53 | 3.7K | |
| 006 Do so - Listening practice (Master).mp4 | 2019-07-03 16:32 | 9.8M | |