![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | 017 Neednt - Meaning and examples (Learn)-en.srt | 2019-07-03 15:54 | 3.4K | |
![[VID]](/icons/movie.gif) | 017 Neednt - Meaning and examples (Learn).mp4 | 2019-07-03 16:31 | 11M | |
| 018 Neednt - Structure (Learn)-en.srt | 2019-07-03 15:54 | 3.7K | |
| 018 Neednt - Structure (Learn).mp4 | 2019-07-03 16:31 | 13M | |
| 019 Neednt - Things to note (Learn)-en.srt | 2019-07-03 15:54 | 1.3K | |
| 019 Neednt - Things to note (Learn).mp4 | 2019-07-03 16:26 | 3.7M | |
| 020 Neednt - Speaking practice (Master)-en.srt | 2019-07-03 15:54 | 2.0K | |
| 020 Neednt - Speaking practice (Master).mp4 | 2019-07-03 16:28 | 5.0M | |
| 021 Neednt - Listening practice (Master)-en.srt | 2019-07-03 15:54 | 4.2K | |
| 021 Neednt - Listening practice (Master).mp4 | 2019-07-03 16:32 | 10M | |
![[ ]](/icons/layout.gif) | 021 Neednt-MP3-transcript.pdf | 2019-07-03 15:55 | 82K | |
![[SND]](/icons/sound2.gif) | 021 Neednt.mp3 | 2019-07-03 16:29 | 4.0M | |
|
|---|